Answer:
68133080.02 g
Explanation:
I believe that the question is to find the mass of air in the room and not the molar mass of air since the molar mass of air was already given in the question as 28.97 g/mol.
Now, if 1 mole of a gas occupies 22.4 L
x moles of air occupies 52,681,428.8 Liters
x = 1 * 52,681,428.8 /22.4
x = 2351849.5 moles of air
Now, number of moles = mass/ molar mass
but molar mass = 28.97 g/mol
2351849.5 = mass/28.97
mass = 2351849.5 * 28.97
mass = 68133080.02 g
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
density=6.74g/ml
:320g÷47.5ml
d=6.74g/ml
thank you
<em><u>I </u></em><em><u>hope</u></em><em><u> </u></em><em><u>this </u></em><em><u>is </u></em><em><u>helpful</u></em>
The answer is A
Mark Brainliest ☺☻