All categories

2 years ago

What protects the cells of plants

Chemistry

2 answers:

gogolik [260]2 years ago

6 0

Explanation:

Plant cells have several structures not found in other eukaryotes. In particular, organelles called chloroplasts allow plants to capture the energy of the Sun in energy-rich molecules; cell walls allow plants to have rigid structures as varied as wood trunks and supple leaves; and vacuoles allow plant cells to change size.

storchak [24]2 years ago

4 0

The cell wall is located outside the cell membrane. It consists mainly of cellulose and may also contain lignin , which makes it more rigid. The cell wall shapes, supports, and protects the cell. It prevents the cell from absorbing too much water and bursting.

You might be interested in

Can someone help me pleasee

Romashka [77]

Answer:

4,1,5,3,2 (from left to right)

8 0

2 years ago

Predidt the direction and the relative value of the dipole moment of the following bond: C-Cl

WINSTONCH [101]

Answer:

D. C → Cl electronegativity difference > 0.5

Explanation:

The electro negativity of an atom in a compound refers to its ability to attract the electrons of a bond towards itself.

On the Pauling's scale, carbon has an electro negativity value of 2.55 while that of chlorine is 3.16. The difference in electro negativity between the both atoms is about 0.61.

The dipole is aslways directed towards the more electronegative atom. Hence the direction is ; C → Cl

5 0

2 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

2 years ago

In this part of the periodic table, what type of elements are in the group that includes elements cu, ag, and au?

tresset_1 [31]

Transition metals are from group 3 to group 12.

3 0

2 years ago

What would happen if the Earth was tilted at 45⁰ rather than 23.5⁰?

denis23 [38]

Answer:

it would cause global warming

Explanation: hope this helps

4 0

2 years ago