It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
let's go to the beach or u will relax lol
all the elements in group 18 are Nobel gases or inert gases . all the elements such as neon , helium, argon etc. ,their outermost shell is completely filled . The noble gases have the largest ionization energies, reflecting their chemical inertness
Runoff (Hope this helped)
Electrons absorb energy, as they absorb energy they go from ground state to excited state and to return to ground state electrons release energy in the form of photons producing that color.
