For the first one, the correct answer would be "<span>Substance changes its form but not its molecular composition.". During a physical change (let's say cutting paper), the substance has its shape changed, but it is still itself (paper).
</span><span>The second one is a bit trickier: </span>
Kinetic energy of a molecule is directly influenced by temperature. If there is a higher temperature it will have a higher kinetic energy which means the molecule moves at a higher velocity. This will increase the chance of particles bouncing off of each other during the chemical reaction. That explains why the rate of reaction will be higher at a higher temperature, rather than higher at a cool temperature. The correct answer would be lower at 39F.
Answer:
Explanation:
Intensity of sound = sound energy emitted by source / 4 π d² , where d is distance of the source .
A )
Intensity of sound at 1 m distance = 60 /4 π d²
d = 1 m
Intensity of sound at 1 m distance = 60 /(4 π 1²)
= 4.78 W m⁻² s⁻¹
B )
Intensity of sound at 1.5 m distance = 60 /4 π d²
d = 1.5 m
Intensity of sound at 1 m distance = 60 /(4 π 1.5²)
= 2.12 W m⁻² s⁻¹
C )
Intensity of sound due to 4 speakers at 1.5 m distance = 4 x 60 /4 π d²
d = 1.5 m
= 4 x 60 /(4 π 1.5²)
= 8.48 W m⁻² s⁻¹
D )
Intensity of sound due to .06 W speaker must be 10⁻¹² W s ⁻² . Let the distance be d .
.06 /4 π d² = 10⁻¹²
d² = .06 /4 π 10⁻¹²
d = 6.9 x 10⁴ m .
Answer b like the last time should be it
B). Some elements found in nature exist as molecules.
That is, their atoms travel around in bound pairs.
Examples are Hydrogen, Oxygen, and Nitrogen.
A). No. Without atoms, you can't make a molecule.
C). No. A compound is a chemical combination of two or more elements.
D). No. An atom is the smallest unit of ONE single element.
C = 5/9 (F-32)Part 1. C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit
