Answer:c
Explanation:
I think because ca^+2
It’s loses the ion and if u look back u would see that a cation is a t charge but it’s not Goan that electron it’s losing that electron
Answer: 90 grams
0.5 molar of glucose means 0.5mole glucose for 1 liter of water. Since we want to made 1L of solution, then the amount of glucose needed is: 0.5mole/l x 1l= = 0.5mole
Glucose molecular weight is 180, then 0,5 mol of glucose is= 0.5mole x 180 grams/mole= 90 grams.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:
In summary, work is done when a force acts upon an object to cause a displacement. Three quantities must be known in order to calculate the amount of work. Those three quantities are force, displacement and the angle between the force and the displacement.
