It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
A. The balloons will increase to twice their original volume.
Explanation:
Boyle's law states that the pressure exerted on a gas is inversely proportional to the volume occupied by the gas at constant temperature. That is:
P ∝ 1/V
P = k/V
PV = k (constant)
P = pressure, V = volume.
Let the initial pressure of the balloon be P, i.e. 
, initial volume be V, i.e. 
. The pressure is then halved, i.e. 
Therefore the balloon volume will increase to twice their original volume.
John Dalton's original atomic theory contained the following key ideas and the incorrect one is that elements are made of tiny indivisible particles called atoms and is denoted as option A.
<h3>What is Atom?</h3>
This is defined as the smallest unit of matter which forms a chemical element and Dalton proposed that it was indivisible which was later proved wrong.
It was later discovered that atom is made up of sub atomic particles such as proton, electron and neutron. This was therefore the reason why option A was chosen as the most appropriate choice.
Read more about Atom here brainly.com/question/6258301
#SPJ1
The options include:
A. elements are made of tiny indivisible particles called atoms
B. Atoms are unchanged in chemical reaction
C. Atoms can join together in whole number ratios to form compounds.
D. The atoms of each element are unique
Answer:
shear walls, cross braces, diaphragms, and moment-resisting frames are central to reinforcing a building. Shear walls are a useful building technology that helps to transfer earthquake forces. Made of panels, these walls help a building keep its shape during movement.
Explanation:
Answer: Option 1, 4 and 5 describe acids accurately.
Explanation:
Option 1: Acids have a sour taste because of the concentration of 
ion.
Option 2: They are corrosive in nature, that is they are not at all gentle with the skin and fabric as some acids intend to burn skin such as 
is a strong acid which can burn skin as well as fabric.
Option 3: Acids need electrons to release ions and non-metals do not donate electrons hence, there is no reaction between a non-metal and an acid.
Option 4: All acids do contain hydrogen. They dissociate in the presence of water to produce ions.
Option 5: Acids do conduct electricity that is they carry electrical charges. This was explained by Arrhenius. He said that the acids dissociate into ions, when it is dissolved in water. These ions hence acts as charge carriers in water.
