The words that complete the blanks are hypothesis and experimentation.
<h3>What is scientific knowledge?</h3>
The process by which scientists obtain information and establish knowledge is;
Observation ---> hypothesis ------> experiments ------> Theory -------> Law.
Thus after the process of observation what we have is merely a scientific hypothesis that needs to pass through the process of rigorous experimentation before it is proven to be true.
Thus the words that complete the blanks are hypothesis and experimentation.
Learn more about scientific knowledge:brainly.com/question/10601194
#SPJ1
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
<span>The answer is B. Convection occurs when hot/warm
water rise to the top and the cold water goes to the bottom in a vessel. This is
because hot/warm water is less dense than cold water. Additionally, convection
currents are well perceptible in air and water and fluid substances that are
poor conductors of heat</span>
Answer:
Please don not post Questions that don'y make sense
Explanation:
P.s: Thanks for the point and have anice day
Answer:
the protein capsid of naked viruses is less susceptible to environmental . condition
Explanation:
because the envelop is made in part of phospholipids. once the envelop is lysed ,the virus loses its functiovnal receptors and still able to infect susceptible cells.
