This is a law because it describes the force but makes not attempt to explain how the force works. A theory is an explanation of a natural phenomenon. Einstein's General Theory of Relativity explains how gravity works by describing gravity as the effect of curvature of four dimensional spacetime.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Molecular mass of Ba3(PO4)2 = 3 × 137.5 + 2 [31 + 4 × 16] = 602.5
Explanation:
hope this helps
plz mark brainliest
Answer:
d. Temperature and number of molecules of gas
Step-by-step explanation:
Boyle's Law states, "The volume of a fixed mass of a gas is inversely proportional to the pressure if the temperature remains constant."
Let's examine the words.
"… volume…is inversely proportional to the pressure …" This means that volume and pressure are the <em>variables</em>.
"… fixed mass of a gas …" means that the number of molecules is constant.
"… temperature remains constant" speaks for itself.
a, c, and e are <em>wrong</em>, because pressure is a variable.
b is <em>wrong</em>, because volume is a variable.
