Answer:
The correct answer is cation. See the explanation below, please.
Explanation:
An atom with a net charge, either positive or negative, is called an ion. In the event that an atom loses an electron (or more), that is, it will have more protons than electrons, and its net charge will be positive, it will be called cation. In the opposite direction, if an atom gains electrons, it will have a negative net charge, called anion.
The net amount of energy produced can be obtained from a table of enthalpy change of formation, available online.
The enthalpy change of formation indicate how much energy the 1 mole of the product (H2O) has relative to the elemental reactants (H2 and O2). In other words, the "lost" energy equals the heat/energy released.
For water (H2O), this value is -285.8 if the final product is a liquid under standard conditions, and -241.82 if the product is in gas form which contains some energy that could be further released. This means that if the final product (H2O) is in liquid form, energy released is 285.8 kJ/mol.
Since water is in liquid form under standard conditions, the first value (285.8 kJ/mol) is generally appropriate.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
google chrome
Explanation:
it is the home button on the top left corner
Answer:
D
Explanation:
A covalent bond is said to be formed when two electrons are shared between two bonding atoms as in the formation of the water molecule.
