A phosphorus atom and a chlorine atom are likely to form a covalent bond because both elements are nonmetals.
Explanation:
i found this the question is different but I think the situation is same
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
+1
Explanation:
Electrochemistry. In oxidation–reduction (redox) reactions, electrons are transferred from one A redox reaction is balanced when the number of electrons lost by the reductant Hg(l)∣Hg2Cl2(s)∣Cl−(aq) ∥ Cd2+(aq)∣Cd(s).
As is evident from the Stock number, mercury has an oxidation state of +1. This makes sense, as chlorine usually has an oxidation state of -1.
Here is what radioactive decay is:
<span>Radioactive decay is the spontaneous breakdown
of an atomic nucleus resulting in the release of energy and matter from
the nucleus. Remember that a radioisotope has unstable nuclei that does
not have enough binding energy to hold the nucleus together.</span>
