<h2>Collision Theory
</h2>
Explanation:
<h3>
The given statement is related to the collision theory -
</h3>
Collision theory was given by William Lewis in 1916.
This theory explains in a qualitative manner that in what way any chemical reaction occurs and the reason for the different reaction rates for different reactions.
<h3>
According to the collision theory -
</h3>
- Molecules must collide in order to react
- Sufficient amount of energy is needed for collisions (kinetic energy) so that the chemical bonds should break
- This energy used is known as the activation energy
- On the increase in the temperature, the kinetic energy of the molecule increases and the molecules move faster and collide with a proper orientation at an increased speed
- This increases the rate of a collision that in turn increases the breaking of the bond
Answer:
Explanation:
A function is a relation in which each input has only one output. In the relation , y is a function of x, because for each input x (1, 2, 3, or 0), there is only one output y. x is not a function of y, because the input y = 3 has multiple outputs: x = 1 and x = 2.
Hope That Helps!!!
Brainliest?
Answer:a lightbulb burning
Explanation:
Apex
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
The Periodic Table is organized in order of atomic number.
Explanation:
Plz give me brainliest I worked hard on this... thank u in advance.
