Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
the sun is the smallest object in our Solar System
Explanation:
The segment that represents melting is time (minutes) and temperature.
The correct answer is From different social and ethnic backgrounds.
Explanation:
The purpose of science studies is to gain an understanding of specific phenomena and use this in the benefit of the world or humanity. Moreover, science is guided by objective methods and these are applied all around the world. This feature allows scientists from all kinds of social and ethnic backgrounds to study the same phenomena and obtain similar results, which is essential for the progress of scientific knowledge. This is exemplified by two different labs in two different countries studying drug absorption because the results of these two studies can be analyzed together to understand drug absorption.
In this context, one factor that contributes to the progress of scientific knowledge is the effort of scientists "from different social and ethnic backgrounds".
The testable question which will provide evidence that elements in the same group have similar properties is valency
<h3>What is the valency?</h3>
In essence, how many electrons are present in their outermost shell.
Valency and Groups in the periodic table, elements are arranged in order of their atomic numbers and hence, the periodic table is a systematic arrangement of elements in an array of vertical columns called Groups and horizontal arrays called Periods.
which of the following testable questions will provide evidence that elements in the same group have similar properties A. Valency B. Orbit C. Group D. Period
Since, the reactive capacities of elements is dependent on the number of electrons on its outermost shell, we can conclude on this note that, Elements in the same group have similar properties.
Learn more on Groups and Valency:
brainly.com/question/1645905
