Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
a) The pressure wiil be twice the original value
Explanation:
Pressure in inversely proportional to volume, that means; when one value decreases at the same rate that the other increases, if the temperature and amount of gas remain unchanged within a closed system. The above derived from the same definition of pressure. The pressure is defined as the crashes and frequency of the same agains surface of objects, if certain amount of gas is contained in a recipent, It will crash more times if the volume is minor. The Boyle´s law express this mathematically.
Answer:
6.75 moles of Ba(NO₃)₂.
Explanation:
The balanced equation for the reaction is given below:
3BaCl₂ + 2Al(NO₃)₃ —> 3Ba(NO₃)₂ + 2AlCl₃
From the balanced equation above,
2 moles of Al(NO₃)₃ reacted to produce 3 moles of Ba(NO₃)₂
Finally, we shall determine the number of mole of Ba(NO₃)₂ produced by the reaction of 4.25 moles of Al(NO₃)₃. This can be obtained as illustrated below:
From the balanced equation above,
2 moles of Al(NO₃)₃ reacted to produce 3 moles of Ba(NO₃)₂.
Therefore, 4.25 moles of Al(NO₃)₃ will react to produce = (4.50 × 3)/2 = 6.75 moles of Ba(NO₃)₂.
Thus, 6.75 moles of Ba(NO₃)₂ were obtained from the reaction.
Answer: Unsaturated Fatty Acids
Explanation: Fatty acid is a long chain of hydrocarbon including a carboxylic group at terminal carbon.
Thus when the fatty acids contain three or ore double bonds between the carbon chains the hydrocarbon chain, it is said to be Unsaturated Fatty Acids.
Unsaturated bonds ae the bonds in which there is a presence of double bonds or triple bonds. These do not come under the category of saturated bonds. Saturated bonds are the single bonds.
Explanation:
<h3>Chemical bonds are forces that hold atoms together to make compounds or molecules. ... Atoms with large differences in electronegativity transfer electrons to form ions. The ions then are attracted to each other. This attraction is known as an ionic bond.</h3>