Nitrogen has 5 valence electrons (ve-), so a diatomic nitrogen molecule will have twice as many, 10 valence electrons. Then, just draw electrons in pairs of 2 until you both get ride of all of them (reach 0) and you fill every atom (eight electrons each). It can be drawn either way, the important thing is that there are 3 electron pairs shared between the two atoms.
1.D 2.A that is pretty hard
Answer:
Explanation:
Accoding to the First Law of Thermodynamics, the heat released by the water melts a portion of ice. That is to say:
The amount of ice that is melt is:
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
The answer is D. Proteins. I know because I tried C. and I got it wrong. It was my last attempt on the quiz, and since I got it wrong they showed me the answer. (i like ur prp btw)
