a. 0.137
b. 0.0274
c. 1.5892 g
d. 0.1781
e. 5.6992 g
<h3>Further explanation</h3>
Given
Reaction
2 C4H10 + 13O2 -------> 8CO2 + 10H2O
2.46 g of water
Required
moles and mass
Solution
a. moles of water :
2.46 g : 18 g/mol = 0.137
b. moles of butane :
= 2/10 x mol water
= 2/10 x 0.137
= 0.0274
c. mass of butane :
= 0.0274 x 58 g/mol
= 1.5892 g
d. moles of oxygen :
= 13/2 x mol butane
= 13/2 x 0.0274
= 0.1781
e. mass of oxygen :
= 0.1781 x 32 g/mol
= 5.6992 g
Answer:
AlCl₃ + 3NaOH → 3NaCl + Al(OH)₃
Explanation:
Problem is to balance the given chemical equation:
Equation:
AlCl₃ + NaOH → NaClO₂ + Al(OH)₃
Balancing a chemical equation involves the conservation of atoms on both sides of the equation.
We can use a very simple mathematical method to balance the above equation;
aAlCl₃ + bNaOH → cNaCl + dAl(OH)₃
a, b, c and d are coefficients that will balance the equation:
Conserving Al: a = d
Cl: 3a = c
Na: b = c
O: b = 3d
H: b = 3d
Assume that a = 1;
c = 3
b = 3
d = 1
AlCl₃ + 3NaOH → 3NaCl + Al(OH)₃
O₂ in from of the NaClO₂ flouts the rule of chemical combination
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer : The concentration of 
ion is 0.0375 M.
Explanation :
The balanced equilibrium reaction will be:
The expression for solubility constant for this reaction will be,
![K_{sp}=[Pb^{2+}][Cl^-]^2](https://tex.z-dn.net/?f=K_%7Bsp%7D%3D%5BPb%5E%7B2%2B%7D%5D%5BCl%5E-%5D%5E2)
Now put all the given values in this expression, we get:
![2.40\times 10^{-4}=[Pb^{2+}]\times (0.0800)^2](https://tex.z-dn.net/?f=2.40%5Ctimes%2010%5E%7B-4%7D%3D%5BPb%5E%7B2%2B%7D%5D%5Ctimes%20%280.0800%29%5E2)
![[Pb^{2+}]=0.0375M](https://tex.z-dn.net/?f=%5BPb%5E%7B2%2B%7D%5D%3D0.0375M)
Therefore, the concentration of ion is 0.0375 M.
