I can see two answers, I’d go with D, but all neutral atoms, of the same element would have the same number of outer electrons. However, if you consider that some of the atoms might be ions, that would eliminate B.
In ionic bonding, atoms SHARE ELECTRONS
Answer:
43.868 J
Explanation:
Kinetic energy of a body is the amount of energy possessed by a moving body. The SI unit of kinetic energy is the joule (kg⋅m²⋅s⁻²).
According to classical mechanics, kinetic energy = 1/2 m·v²
Where, m= mass in kg and v= velocity in m/s
Given: m = 19.2 lb and v = 7.10 miles/h
Since, 1 lb= 0.453592 kg
∴ m = 19.2 lb = 19.2 × 0.453592 kg = 8.709 kg
Also, 1 mi = 1609.34 m and 1 h = 3600 sec
∴ v = 7.10 mi/h = 7.10 × 1609.34 m ÷ 3600 sec = 3.174 m/sec
Therefore, <u>kinetic energy of the goose</u> = 1/2 m·v² = 1/2 × (8.709 kg)× (3.174 m/sec)² = 43.868 J
A because cation is positive and anion is negative evening it out at constant.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
