Sublimation. Sublimation is the change of a solid direct to gas or vapour without becoming liquid
Answer:
Hello There!!
Explanation:
The answer is B.Year
It takes 365 days for the earth to orbit the sun. 365 days is 1 year.
hope this helps,have a great day!!
~Pinky~
Answer:
False
Explanation:
It's classified as a dwarf planet, but not technically a planet.
Heart: Pumps blood through the body
Bone: Provides structure
Stomach: Breaks down food into small particles
Lungs: Oxygenates blood
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane