8.1*10tothe14hz thanks for askin
Answer:
Explanation:
Hello,
At first, the answer is wrong, consider the following procedure:
- the pKs, leads to a Ks of:
- now, stating the equilibrium for the calcium sulfate (whereas x is the change during the equilibrium):
![Ks=[Ca^{+2}]^{eq}[SO_{4}^{-2}]^{eq}\\Ks=[x]^{eq}[x]^{eq}\\Ks=x^{2}\\x=\sqrt{2.63x10^{-5}}\\x=5.13x10^{-3} M](https://tex.z-dn.net/?f=Ks%3D%5BCa%5E%7B%2B2%7D%5D%5E%7Beq%7D%5BSO_%7B4%7D%5E%7B-2%7D%5D%5E%7Beq%7D%5C%5CKs%3D%5Bx%5D%5E%7Beq%7D%5Bx%5D%5E%7Beq%7D%5C%5CKs%3Dx%5E%7B2%7D%5C%5Cx%3D%5Csqrt%7B2.63x10%5E%7B-5%7D%7D%5C%5Cx%3D5.13x10%5E%7B-3%7D%20M)
- x becomes the concentration of calcium ions and one of the contributions for the total concentration of sulfate ions, thus:
![[Ca^{+2}]^{eq}=5.13x10^{-3} M](https://tex.z-dn.net/?f=%5BCa%5E%7B%2B2%7D%5D%5E%7Beq%7D%3D5.13x10%5E%7B-3%7D%20M)
- finally, since the sodium sulfate is totally dissolved, we just simply add its concentration (equal to the sulfate ions yielded by itself) to the outgoing sulfate concentration from the calcium sulfate:
![[SO_4^{-2}]^{total}=5x10^{-3}M+5.13x10^{-3}M\\[SO_4^{-2}]^{total}=0.010 M](https://tex.z-dn.net/?f=%5BSO_4%5E%7B-2%7D%5D%5E%7Btotal%7D%3D5x10%5E%7B-3%7DM%2B5.13x10%5E%7B-3%7DM%5C%5C%5BSO_4%5E%7B-2%7D%5D%5E%7Btotal%7D%3D0.010%20M)
Bibliography:https://books.google.com.co/books?id=LQwyfFc3pXsC&lpg=PA243&ots=zIJN3nSFWE&dq=pKs%20chemistry&pg=PA244#v=onepage&q=pKs%20chemistry&f=false page 243
Best regards!
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
D. A force pushes upon a object that stays in place.
Explanation:
Answer:
when the water vapor condenses to the clouds which causes the clouds to become warm, which the makes it rain which this process is now called precipitation, then the rain decomposes when it forms from gas to a solid. and when the sun warms up the water, the water evaporates then enters a new process called evaporation.
Explanation:
The water cycle is the continuous movement of water in and around the Earth. As previously mentioned, water never really goes away -- it just changes form. The sun drives the entire water cycle and is responsible for its two major components: condensation and evaporation. When the sun heats the surface of water, it evaporates and ends up in the atmosphere as water vapor. It cools and rises, becoming clouds, which eventually condense into water droplets. Depending on the temperature of the atmosphere and other conditions, the water precipitates as rain, sleet, hail or snow.
