Answer: Option (C) is the correct answer.
Explanation:
In a substance, the total energy of its molecular motion is known as heat. Whereas when we measure the average energy of molecular motion of a substance then it is known as temperature.
So, any increase or decrease in temperature will lead to change in heat of a substance.
When one mole of a substance is burned then the amount of energy released in the form of heat is known as heat of combustion.
Relation between heat and temperature is as follows.
q =
Thus, we can conclude that to measure the enthalpy of combustion it cannot be measured, only calculated using the equation; q = .
Fe O
2 3 is what i would put
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer:
for the given reaction is -238.7 kJ
Explanation:
The given reaction can be written as summation of three elementary steps such as:
---------------------------------------------------------------------------------------------------