Answer:
Water would not be able to transport nutrients -‐-‐ in plants, or in our bodies -‐-‐ nor to dissolve and transport waste products out of our bodies. ... Cohesiveness, adhesiveness, and surface tension: would decrease because without the +/-‐ polarity, water would not form hydrogen bonds between H20 molecules.
So 6.02*10^22 is avogadro constant, which is the amount of atoms in one mole. If you look Xenon up in the periodic table you will find it's mass given <span>131,293, which is grams per 1 mole.
</span>
<span>The correct answer is A, the ligt-dependent reactions. These reactions are responsible for the production of glucose molecules, by the utilization of carbon dioxide, and water along with the sunlight. Glucose is then broken down during resiration process, for the production of ATP in mitochondria.</span><span />
This is to fill in the answer to the question.
The area where the blast originates is referred to as <span>Scene Perimeter/Isolation Zone. This whole area is dangerous for people since it can contain harmful gasses or falling debris depending on the environment of the blast.
</span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH