In scientific notation, a number is less than ten but more than one.
Move the decimal point from 0, 250.000 <- this is the same as 250 to between 2 and 5.
I had to move two spaces.
2.5^2
I hope this helps!
~kaikers
Plastics and polysaccharides are somewhat similar because they are both polymers. Polymers are a long chain of repeating units called monomers. Their difference, however, is the identity of their monomers. Plastics have hydrocarbons as monomers. Plastics with the monomer ethene is called polyethylene. For polysaccharides, their monomers are simple sugars.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Kr look on periodic table it's krypton elements
Answer:
The removal of one or more electrons from a neutral atom results in a cation.
Explanation:
When you remove electrons from a neutral atom, the atom becomes more positive. Electrons have a negative charge and the protons inside of the nucleus have a positive charge. When electrons are removed, the positive charges from the protons outweigh the negative charges. This results in a positively charged atom, called a cation.