Answer:
The cis double bond present in unsaturated fatty acids acids results in lower melting point when compared to saturated fatty acids of the same chain length.
Explanation:
Melting point of a fatty acids are affected by the length and degree of unsaturation of the hydrocarbon chain.
At room temperature, saturated fatty acids with hydrocarbon chain lengths between 12-24 are waxy solids whereas unsaturated atty acids of the same chain length are liquids. This is due to the nature of the packing of the fatty acid molecules in the saturated and unsaturated compounds.
In the saturated compounds, the molecules are tightly packed side by side with minimal steric hindrance and maximal van der Waals forces of attraction between molecules. However, in unsaturated fatty acids, the cis double bond introduces a bend or kink in the molecules which then interferes with the tight packing of the molecules and reducing interaction between molecules. Therefore, less energy is required to cause a disorder in the arrangement of unsaturated fatty acids, leading to a lowering of melting point.
Answer is: C₃H₃N₃O₃.
Chemical reaction: CₓHₓNₓOₓ + O₂ → aCO₂ + x/2H₂ + x/2N₂.
m(CₐHₓNₓ) = 5,214 g.
m(CO₂) = 5,34 g.
m(H₂) = 1,09 g.
m(N₂) = 1,70 g.
n(CO₂) = n(C) = 5,34 g ÷ 44 g/mol = 0,121 mol.
n(H₂O) = 1,09 g ÷18 g/mol = 0,06 mol.
n(H) = 2 · 0,0605 mol = 0,121 mol.
n(N₂) = 1,7 g ÷ 28 g/mol = 0,0607 mol.
n(N) = 0,0607 mol · 2 = 0,121 mol.
n(C) : n(H) : n(N) = 0,121 mol : 0,121 mol : 0,121 mol /: 0,121
n(C) : n(H) : n(N) = 1 : 1 : 1.
M(CHN) = 27 g/mol.
m(O₂) = 8,13 g - 5,214 g = 2,914 g.
n(O₂) = 2,914 g ÷ 32 g/mol = 0,09 mol.
n(CₓHₓNₓOₓ) = 5,214 g ÷ 129,1 g/mol = 0,0404 mol.
n(CₓHₓNₓOₓ) : n(CO₂) = 1 : 3.
Answer:
Both liquids and gases are fluids = true
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
10 g/ml
Explanation:
divide mass by volume means divide 1000 by 100 and your answer will be 10
