The answer is c.diffusion.
Diffusion is the movement of ions, molecules or atoms form high concentration to low concentration across the membrane without the need of any energy or any membrane gates. The oxygen enters the alveoli will be dissolved in the water vapor that is present on the wall of the alveoli and will diffuse directly to the blood across the alveolar membrane.
The answer to your question is A <span>4.184 J</span>
Answer:
A and B
Explanation:
This is because there was emission of gamma (Y) radiations in both the reactions.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
From the periodic table:
molecular mass of carbon = 12 grams
molecular mass of fluorine = 18.99 grams
molecular mass of chlorine = 35.5 grams
Therefore:
one mole of CF2Cl2 = 12 + 2(18.99) + 2(35.5) = 120.98 grams
Therefore, we can use cross multiplication to find the number of moles in 79.34 grams as follows:
mass = (79.34 x 1) / 120.98 = 0.6558 moles
Now, one mole contains 6.022 x 10^23 molecules, therefore:
number of molecules in 0.65548 moles = 0.6558 x 6.022 x 10^23
= 3.949 x 10^23 molecules
