Your balanced equation for this reaction is:
HCOOH (aq) + H2O (aq) → HCOO- (aq) + H3O+ (aq)
So from the reaction, we can see when formic acid dissolved in water so H3O+ ions will be formed.
and we can see that it is a balanced equation as:
we have H atoms = 4 on both sides of the reaction
and C atoms = 1 atom on both sides of the reaction
and O atoms = 3 atoms on both sides of the reaction
So it is our final balanced equation of the reaction.
Answer:
trans-1,3-pentadiene is more stable than 1,4-pentadiene due to presence of a conjugated double bond.
Explanation:
Here, 
H(hydrogenated pdt.) is same for both 1,4-pentadiene and 1,3-pentadiene as they both produce pentane after hydrogenation
H(diene) depends on stability of diene.
More stable a diene, lesser will be it's H(diene) value (more neagtive).
trans-1,3-pentadiene is more stable than 1,4-pentadiene due to presence of a conjugated double bond.
Hence, 
is higher (less negative) for trans-1,3-pentadiene
Answer:A.) molecule of atoms forms
Explanation:
I put the answer <em>C: Keq will increase</em>, on PLATO. Hope this works for you!
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
