Answer:
1. 25 moles water.
2. 41.2 grams of sodium hydroxide.
3. 0.25 grams of sugar.
4. 340.6 grams of ammonia.
5. 4.5x10²³ molecules of sulfur dioxide.
Explanation:
Hello!
In this case, since the mole-mass-particles relationships are studied by considering the Avogadro's number for the formula units and the molar mass for the mass of one mole of substance, we proceed as shown below:
1. Here, we use the Avogadro's number to obtain the moles in the given molecules of water:
2. Here, since the molar mass of NaOH is 40.00 g/mol, we obtain:
3. Here, since the molar mass of C6H12O6 is 180.15 g/mol:
4. Here, since the molar mass of ammonia is 17.03 g/mol:
5. Here, since the molar mass of SO2 is 64.06 g/mol:
Best regards!
Double replacement is happening
I believe it is C, but I can't guarantee it.
Answer:
By measuring it's Radical velocity using Doppler Phenomenon...
Explanation:
It is done by measuring the absorption spectrum produces by a star as a result of measuring Doppler's relative wavelength. The star with the lower speed must have lower absorption spectrum extent as compared to the faster one.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
