Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
HCl(aq) + KOH(s) --> KCl(aq) + H2O(l)
Answer:
3AgCl + Na₃PO₄ —> 3NaCl + Ag₃PO₄
The coefficients are 3, 1, 3, 1
Explanation:
From the question given above, the following data were:
Silver chloride reacts with sodium phosphate to yield sodium chloride and silver phosphate. This can be written as follow:
AgCl + Na₃PO₄ —> NaCl + Ag₃PO₄
The above equation can be balanced as follow:
AgCl + Na₃PO₄ —> NaCl + Ag₃PO₄
There are 3 atoms of Na on the left side and 1 atom on the right side. It can be balance by putting 3 in front of NaCl as shown below:
AgCl + Na₃PO₄ —> 3NaCl + Ag₃PO₄
There are 3 atoms of Cl on the right side and 1 atom on the left. It can be balance by putting 3 in front of AgCl as shown below:
3AgCl + Na₃PO₄ —> 3NaCl + Ag₃PO₄
Thus, the equation is balanced.
The coefficients are 3, 1, 3, 1
Answer:
8.73
Explanation:
when you are adding or subtracting numbers, the sigfig (significant figure) is based on how many numbers after the decimal. with this info, we can see that 15.67 has 2 sigfigs and 6.943 has 3 sigfigs. when you subtract normally, you would get 8.727, which has 3 sigfigs, so you would round the last 7 up to get 8.73 with 2 sigfigs!
also it is to 2 sigfigs because we know that we go by the least number of sigfigs. hope this helped!
