Answer:
An amide may be produced by reacting an acid chloride with ammonia.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:- 1840 g.
Solution:- We have been given with 3.35 moles of and asked to calculate it's mass.
To convert the moles to grams we multiply the moles by the molar mass of the compound. Molar mass of the compound is the sum of atomic masses of all the atoms present in it.
molar mass of = atomic mass of Hg + 2(atomic mass of I) + 6(atomic mass of O)
= 200.59+2(126.90)+6(16.00)
= 200.59+253.80+96.00
= 550.39 gram per mol
Let's multiply the given moles by the molar mass:

= 1843.8 g
Since, there are three sig figs in the given moles of compound, we need to round the calculated my to three sig figs also. So, on rounding off to three sig figs the mass becomes 1840 g.
Answer:
Plants add water to the atmosphere
Explanation:
In Chemistry, to better determine the position of a certain electron, quantum numbers are used. The four quantum numbers are n, l, m and s. In the given above of n= 4, the principal quantum number is 4 and this represents the overall relative energy in the orbital. This means that we are to find the maximum number of electrons in fourth main energy level and the answer is 32.