Answer:
C21H30O5
Explanation:
Cortisol with molecular formula C21H30O5 is a steroid hormone released by adrenal glands, it is involved in protein synthesis and can also help to control blood sugar level .
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
When heat is added to a substance, the molecules and atoms vibrate faster. As atoms vibrate faster, the space between atoms increases. The motion and spacing of the particles determines the state of matter of the substance. The end result of increased molecular motion is that the object expands and takes up more space.
Explanation:
Hope this helps :)
Synthesis. Which is "<span>Noun. (plural syntheses) The formation of something complex or coherent by combining simpler things. (chemistry) The reaction of elements or compounds to form more complex compounds.".....According to www.dictionary.com.</span>
Silicon, it's bring brother would be the prime candidate, although its compounds are notably different from those of carbon.