Answer: A woman kicks a soccer ball and scores a goal.
Explanation:
Potential energy: it is the energy possessed by the body due to its position.
Kinetic energy: it is the energy possessed by the the body due to its motion.
When a woman kick's a soccer ball she transferred her potential energy to soccer ball.Due to this action soccer ball comes into motion which means potential energy imparted to the ball starts getting converted into kinetic energy.
Answer:
Part A
Ag+ is the Lewis acid and NH3 is the Lewis base.
Part B
AlBr3 is the Lewis acid and NH3 is the Lewis base.
Part C
AlCl3 is the Lewis acid and Cl− is the Lewis base.
Explanation:
A Lewis acid is any specie that accepts a lone pair of electrons. Ag^+, AlBr3 and AlCl3 all accepted lone pairs of electrons according to the three chemical reaction equations shown. Hence, they are Lewis acids.
A Lewis base donates a lone pair of electrons. They include neutral molecules having lone pair of electrons such as NH3 or negative ions such as Cl- .
Explanation:
The given data is as follows.
Weight of solute = 75.8 g, Molecular weight of solute (toulene) = 92.13 g/mol, volume = 200 ml
- Therefore, molarity of toulene is calculated as follows.
Molarity = 
= 
= 4.11 M
Hence, molarity of toulene is 4.11 M.
- As molality is the number of moles of solute present in kg of solvent.
So, we will calculate the molality of toulene as follows.
Molality = 
= 
= 8.6 m
Hence, molality of given toulene solution is 8.6 m.
- Now, calculate the number of moles of toulene as follows.
No. of moles = 
= 
= 0.8227 mol
Now, no. of moles of benzene will be as follows.
No. of moles = 
= 
= 1.2239 mol
Hence, the mole fraction of toulene is as follows.
Mole fraction = 
= 
= 0.402
Hence, mole fraction of toulene is 0.402.
- As density of given solution is 0.857
so, we will calculate the mass of solution as follows.
Density = 
0.857
=
(As 1
= 1 g)
mass = 171.4 g
Therefore, calculate the mass percent of toulene as follows.
Mass % = 
= 
= 44.22%
Therefore, mass percent of toulene is 44.22%.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs