Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
In a video game, a flying coconut moves at a constant velocity of 20 meters/second. The coconut hits an obstacle and moves in the opposite direction with a constant velocity of 10 meters/second.
Explanation:
