Answer: The complete reaction is as follows.
Explanation:
When nucleus of two or more atoms are bombarded together then it leads to the formation of new particles with new identity. This type of reaction are called nuclear reaction.
For example, 
Here, nitrogen atom when bombarded with a neutron then it is forming hydrogen and a carbon atom.
As total atomic mass on reactant side is (14 + 1) = 15
So, the atomic mass of carbon formed on product side is (15 - 1) = 14.
The number of protons holded by this carbon atom is (7 - 1) = 6.
Therefore, we can conclude that the complete reaction is as follows.
Nothing unless it was dug out from roots if not they would grom back in a long period of time
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Explanation:
Molar mass of KF= 39 + 19= 58g/mol
Mass of KF = 109g
Amount = mass/molar mass
Amount = 109/58
Amount = 1.9moles
Answer:
It's false ok it's non electrolyte
