That’s a hard one, but honestly i would go with a.
Answer: The movement of heat from a warmer object to a cooler one is called heat transfer
Explanation:
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
140. J/g*K
Explanation:
To find the specific heat capacity, you need to use the following equation:
Q = mcΔT
In this equation,
-----> Q = energy/heat (J)
-----> m = mass (g)
-----> c = specific heat (J/mole*K)
-----> ΔT = change in temperature (K)
Before you can use the equation above, you need to (1) convert kg to grams, then (2) convert grams to moles (via molar mass), and then (3) convert Celsius to Kelvin. The final answer should have 3 significant figures.
1.11 kg C₄H₈O₂ x 1,000 = 1110 g
Molar Mass (C₄H₈O₂): 4(12.01 g/mol) + 8(1.008 g/mol) + 2(16.00 g/mol)
Molar Mass (C₄H₈O₂): 88.104 g/mol
1110 grams C₄H₈O₂ 1 mole
------------------------------ x ------------------------- = 12.6 moles C₄H₈O₂
88.104 grams
34.5 °C + 273 = 307.5 K
52.3 °C + 273 = 325.3 K
Q = mcΔT <----- Equation
3.14 x 10⁴ J = (12.6 moles)c(325.3 K - 307.5 K) <----- Insert values
3.14 x 10⁴ J = (12.6 moles)c(17.8) <----- Subtract
3.14 x 10⁴ J = (224.28)c <----- Multiply 12.6 and 17.8
140. = c <----- Divide both sides by 224.28
**this answer may be slightly off due to using different molar masses/Kelvin conversions**
Acid and bases both are the substances that cause corrosion. They can be differentiated on the basis of properties and pH.
If the pH is less than 7.0 the solution is acidic while if its value is greater than 7.0 it is the basis solution.
Examples:
Acid
Acetic acid has pH value 2.4
Sulphuric acid has pH value 0 for 1M solution
Base
pH of ammonia solution is 11
