H₂SO₄ + Ba(OH)₂ -----> BaSO₄ + 2H₂O
Coefficient for sulfuric acid: 1
Answer:
V₂ = 5.97 L
Explanation:
Given data:
Initial temperature = 9°C (9+273 = 282 K)
Initial volume of gas = 6.17 L
Final volume of gas = ?
Final temperature = standard = 273 K
Solution:
Formula:
The Charles Law will be apply to solve the given problem.
According to this law, 'the volume of given amount of a gas is directly proportional to its temperature at constant number of moles and pressure'
Mathematical expression:
V₁/T₁ = V₂/T₂
V₁ = Initial volume
T₁ = Initial temperature
V₂ = Final volume
T₂ = Final temperature
Now we will put the values in formula.
V₁/T₁ = V₂/T₂
V₂ = V₁T₂/T₁
V₂ = 6.17 L × 273K / 282 k
V₂ = 1684.41 L.K / 282 K
V₂ = 5.97 L
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
<span>There are divergent boundaries where the plates are moving away from each other, causing magma to rise up. The boiling lava is almost immediately cooled and forms new sea floor crust.</span>
