All categories

2 years ago

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

Chemistry

1 answer:

nadezda [96]2 years ago

4 0

Answer:

1-bromo-6-chloro-5-methylheptane

Explanation:

There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.

The longest carbon chain consists of 7 carbons.

There are no double bonds, based on the saturation and substituents.

So you have a 1-bromo-6-chloro-5-methylheptane.

Hope that was the brainliest answer!

You might be interested in

How do you use the changes in the phase of water to keep you cool?

sineoko [7]

Answer:

by freezing

Explanation:

8 0

3 years ago

How many moles of HCl are present in 4.7 L of a 4.23 M HCl solution?

REY [17]

Hey There!

Volume = 4.7 L

Molarity = 4.23 M

Therefore:

n = M *V

n = 4.23 * 4.7

n = 19.881 moles of HCl

hope this helps!

6 0

3 years ago

explain the law of conservative of energy, give a specific example using kinetic and potential energy that shows how energy is c

KiRa [710]

Answer:

The Law of Conservation of Energy states that energy cannot be created or destroyed. In other words, the total energy of a system remains constant. This is an important concept to remember when dealing with energy problems. The two basic forms of energy that we will focus on are kinetic energy and potential energy.

Explanation:

In physics and chemistry, the law of conservation of energy states that the total energy of an isolated system remains constant; it is said to be conserved over time. This law means that energy can neither be created nor destroyed; rather, it can only be transformed or transferred from one form to another.

Im bad at these questions hope it helps and have a good day.

8 0

3 years ago

What information is given by the superscripts in an electron configuration?

Paraphin [41]

<span>The superscripts in an electron configuration represents the number of electrons and protons in an element. </span>

8 0

3 years ago

Anh measured the temperature of a pond near his house. Before he left for school, the water in the pond was 18 degrees celsius.

Hitman42 [59]

As the temperature increases, B) the molecules started moving faster.

Explanation:

The temperature of a substance is a measure of the average kinetic energy of the particles in a substance. In particular, it can be found that the temperature is directly proportional to the average kinetic energy of the particles:

$T\propto KE$

The kinetic energy of a particle is given by

$KE=\frac{1}{2}mv^2$

where

m is the mass of the particle

v is its speed

This means that the higher the temperature of a substance, the greater the speed of the particles in the substance.

Therefore, if we apply this concept to this problem, we infer that as the temperature of the water in the pond gets higher, the speed of the molecules inside the water increases, which means that the molecules are moving faster.

Therefore, the correct answer is

B) the molecules started moving faster.

Learn more about temperature:

brainly.com/question/1603430

brainly.com/question/4370740

#LearnwithBrainly

3 0

4 years ago