All categories

2 years ago

Explain what is meant by the phrase 'the heat death of the universe."

Chemistry

2 answers:

jek_recluse [69]2 years ago

7 0

Answer:

hypothesis on the ultimate fate of the universe, which suggests the universe would evolve to a state of no thermodynamic free energy and would therefore be unable to sustain processes that increase entropy.

Explanation:

Vikki [24]2 years ago

6 0

Answer:

See explanation.

Explanation:

Are you literally posting your entire you chemistry homework on this site, one question at a time? Anyways, the heat death refers to the second law of thermodynamics and entropy. Heat is constantly flowing from warmer to cooler objects and never the other way around. This heat flow increases entropy, which is constantly increasing. The universe will eventually disperse all of its heat energy away to continuously increase entropy and reach a limit as the temperature reaches 0 K at which point all molecular motion will cease and so will the life of the universe.

You might be interested in

4. Does an atom of an element always have the same number of neutrons as other atoms of the same

Sergeeva-Olga [200]

Explanation:

No. Isotopes are atoms of the same element with different atomic masses (due to the different number of neutrons)

For example, carbon exists as carbon-12 and carbon-14, which both have 6 protons but have 6 and 8 neutrons respectively.

6 0

3 years ago

Use the definition of molarity to calculate the concentration of 12.34 g of CaSO4 completely dissolved in water, with a solution

Ede4ka [16]

Answer:

[CaSO₄] = 36.26×10⁻² mol/L

Explanation:

Molarity (M) → mol/L → moles of solute in 1L of solution

Let's convert the volume from mL to L

250 mL . 1L/1000 mL = 0.250L

We need to determine the moles of solute. (mass / molar mass)

12.34 g / 136.13 g/mol = 0.0906 mol

M → 0.0906 mol / 0.250L = 36.26×10⁻² mol/L

8 0

3 years ago

What is the mass of 11.4 L of NO2

kodGreya [7K]

At STP volume is 22.4 L

Molar mass NO₂ = 46.0 g/mol

1 mole ---------- 22.4 L
? mole ---------- 11.4 L

moles = 11.4 * 1 / 22.4

moles = 11.4 / 22.4

= 0.5089 moles of NO₂

Mass NO₂ :

moles NO₂ * molar mass

0.5089 * 46.0

= 23.4094 g of NO₂

hope this helps!

7 0

3 years ago

A little boy has placed his pet squirrel into a balloon with a volume of 3L at a pressure of 1.0 atm. If the boy takes his pet s

s2008m [1.1K]

Answer: The squirrel's balloon will be 0.86 L

Explanation:

To calculate the new volume, we use the equation given by Boyle's law. This law states that pressure is directly proportional to the volume of the gas at constant temperature.

The equation given by this law is:

$P_1V_1=P_2V_2$

where,

$P_1\text{ and }V_1$ are initial pressure and volume.

$P_2\text{ and }V_2$ are final pressure and volume.

We are given:

$P_1=1.0atm\\V_1=3L\\P_2=3.5atm\\V_2=?$

Putting values in above equation, we get:

$1.0\times 3L=3.5\times V_2\\\\V_2=0.86$

Thus the squirrel's balloon will be 0.86 L

7 0

3 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago