I think your answer is D. However I’m not 100% sure.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
pH of resulting solution = 7.98
Explanation:
The balanced equation
HA + NaOH - Na+ + A- + H2O
Number of moles of A = Number of moles of HA = Number of moles of NaOH
= 35.8/1000 * 0.020 = 0.000716 mol
Initial concentration of A = 0.000716/0.0608 = 0.01178 M
pKb = 14 – pKa = 14 -3.9 = 10.1
Kb = 10^{-Kb} = 10^{-10.1} = 7.943 * 10^-11
Kb = [HA][OH-]/[A-]
Kb = a^2/(0.01178 -a) = 7.943 * 10^-11
a^2 + 7.943 * 10^-11 a – 9.357 * 10^-13 = 0
a = 9.673 * 10^-7
OH- = a = 9.673 * 10^-7 M
pOH = -log [OH-] = -log (9.673 * 10^-7) = 6.02
pH = 14-6.02 = 7.98
Answer:
Bacteria
Explanation:
hope this helps please gimme brainliest
