At equivalence there is no more HA and no more NaOH, for this particular reaction. So that means we have a beaker of NaA and H2O. The H2O contributes 1 x 10-7 M hydrogen ion and hydroxide ion. But NaA is completely soluble because group 1 ion compounds are always soluble. So NaA breaks apart in water and it just so happens to be in water. So now NaA is broken up. The Na+ doesn't change the pH but the A- does change the pH. Remember that the A anion is from a weak acid. That means it will easily attract a hydrogen ion if one is available. What do you know? The A anion is in a beaker of H+ ions! So the A- will attract H+ and become HA. When this happens, it leaves OH-, creating a basic solution, as shown below.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer: It's frequency also increases.
Explanation:
The sound is perceived as louder if the amplitude increases, and softer if the amplitude decreases. ... The amplitude of a wave is related to the amount of energy it carries. A high amplitude wave carries a large amount of energy; a low amplitude wave carries a small amount of energy.
Hope this helps! Have a blessed day! Please mark me as brainlyest!?
It is an endothermic reaction because the products hAve more heat than the reactions so it was a gain of heat which makes the enthalpy Change positive !
