All categories

2 years ago

What is the force that holds atoms together

Chemistry

1 answer:

ololo11 [35]2 years ago

7 0

Explanation:

Chemical bond refers to the forces holding atoms together to form molecules and solids. This force is of an electric nature, and the attraction between electrons of one atom to the nucleus of another atom contributes to what is known as chemical bonds.

You might be interested in

Put 34,100,000 in scientific notation

ss7ja [257]

Answer:

3.41 x 10^7

Explanation:

5 0

4 years ago

Balance this equation<br> Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)

zzz [600]

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

<span>Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)</span>

3 0

4 years ago

Show the calculation of the mole fraction of each gas in a 1.00 liter container holding a mixture of 8.65 g of CO2 and 4.32 g of

Vlad1618 [11]

Answer:

0.745 and 0.245

Explanation:

Mole fraction (χ) is the number of moles of a component divided by the total number of moles in a mixture.

We must calculate the moles of each component.

Let CO₂ be Gas 1 and SO₂ be Gas 2.

1. Calculate the moles of each gas.

$\text{n} _{1} = \text{8.65 g} \times \dfrac{\text{1 mol}}{\text{44.01 g}} = \text{0.1965 mol}\\\\\text{n} _{2} = \text{4.32 g} \times \dfrac{\text{1 mol}}{\text{64.06 g}} = \text{0.067 44 mol}$

2. Calculate the total moles.

$n_{\text{tot}} = \text{n}_{1} + \text{n}_{2} = \text{0.1965 mol} +\text{0.067 44 mol} = \text{0.2640 mol}$

3. Calculate the mole fraction of each component

$\chi_{1} =\dfrac{0.1965}{0.2640} = \mathbf{0.745}\\\\\chi_{2} =\dfrac{0.06744}{0.2640} = \mathbf{0.255}$

6 0

3 years ago

What is the solar mass of CHCI3?

4vir4ik [10]

Molar mass of CHCl3 is

sum of atomic mass of all the atoms in it.

= C + H + 3 Cl

= 12.0107 + 1.008 + 3 (35.453) = 2.0107 + 1.008 + 106.359

= 119.38 g/mol

Molar mass of CHCl3 is 119.38 g/mol

5 0

3 years ago

An oxide has a chemical formula with the form X2O3. Which group is element X more likely to be a member of? Select the correct a

3241004551 [841]

Answer:

Group 13

Explanation:

You know X has 3 valence electrons, as oxygen has a subscript of 3. This means X has an ionic charge of +3. Group 13 consists mainly of metalloids but it also has metals such as aluminum, which has a +3 charge. If you use aluminum as an example, you know that when combined with oxygen, it forms Al2O3. Group 12 has transition metals that don't have +3 ionic charges, group 14 has metalloids, metals that don't have ionic charges of +3, and nonmetals, and group 2 has metals with ionic charges of +2. Group 13 is the answer.

5 0

3 years ago