Explanation:
The atomic number is equal to the number of protons in an atom's nucleus. Hydrogen's atomic number is 1 because all hydrogen atoms contain exactly one proton.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The answer is 2 15 12 6
hope this would help you
Answer: its millimeters
Explanation: we use millimeters foe liquids like water for example
Answer:
0.581 L or 581 mL
Explanation:
As stated in the question, the combined gas law is (P1*V1/T1) = (P2*V2/T2)
Write down the amounts you are given.
V1 = 0.152 L (I was taught to always convert milliliters to liters)
P1 = 717 mmHg
T1 = 315 K
V2 = ?
P2 = 463 mmHg
T2 = 777 K
The variable that is being solved for is final volume. Fill in the combined gas law equation with the corresponding amounts and solve for V2.
(717 mmHg*0.152 L) / (315 K) = (463 mmHg*V2) / (777 K)
0.346 = (463*V2) / (777)
0.346*777 = (463*V2) / (777)*777
268.842 = 463*V2
268.842/463 = (463*V2)/463
V2 = 0.581
Pressure and volume are indirectly proportional. This checks out because the volume increased while pressure decreased. Volume and temperature are directly proportional. This checks out because both volume and temperature increased. This is a good way to check your answers. You can also solve each side of the combined gas law equation to see if they are both the same.
