Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Water, 35 liters. Carbon, 20 kilograms. Ammonia, 4 liters. Lime, 1.5 kilograms. Phosphorous, 800 grams. Salt, 250 grams. Saltpeter, 100 grams. Sulfur, 80 grams. Fluorine, seven-point-five. Iron, five. Silicon, three grams. And trace
amounts of 15 other elements.
the ingredients of the average adult,right down to the last specks of protein in your eyelashes. And even though science has given us the entire physical breakdown, there's never been a successful attempt at bringing a human to life. There's still something missing. Something scientists haven't been able to find in centuries of research. ...and in case you're wondering, all those ingredients can be bought on a child's allowance. humans can be made rather cheap. There's no magic to it.
Answer:
Dioxide tetrachloride
Explanation:
Di meaning 2 as in o2 and tetra the Greek numerical for 4 attached to chlorine in a group it is Chloride.
Scientists use scientific notation to communicate extremely small measurements. Hence, option A is correct.
<h3>What scientific notation?</h3>
Scientific notation is a way of writing very large or very small numbers.
Scientists use scientific notation to represent very small or very large numbers because this notation increases the
- accuracy of measured quantities.
- convenience in using the numbers.
- the number of significant figures.
- precision of measurements.
Hence, option A is correct.
Learn more about the scientific notation here:
brainly.com/question/18073768
#SPJ1
The Moon<span> moves </span>around<span> the </span>Earth in<span> an </span>approximately<span> circular </span>orbit<span>, going once </span>around<span> </span>in approximately<span> 27.3 </span><span>days. </span>The moon orbits quite fast: it moves about 0.5 degrees<span> per hour in the sky. So, its average movement in a day is around 13 degrees. 5 days x 13 degrees is approximately 65 degrees. </span>