What is one element a topographic map shows? Air flow Climate People Relief

How many moles of 0.225 M CaOH2 are present in 0.350 L of solution?

weeeeeb [17]

Answer : The number of moles of solute $Ca(OH)_2$ is, 0.0788 moles.

Explanation : Given,

Molarity = 0.225 M

Volume of solution = 0.350 L

Formula used:

$\text{Molarity}=\frac{\text{Moles of }Ca(OH)_2}{\text{Volume of solution (in L)}}$

Now put all the given values in this formula, we get:

$0.225M=\frac{\text{Moles of }Ca(OH)_2}{0.350L}$

$\text{Moles of }Ca(OH)_2=0.0788mol$

Therefore, the number of moles of solute $Ca(OH)_2$ is, 0.0788 moles.

7 0

3 years ago

Can someone help me I would really appreciate it

slega [8]

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

8 0

4 years ago

A chemist weighed out 20.7 g of sodium . Calculate the number of moles of sodium she weighed out

Pachacha [2.7K]

Answer:

about 0.9 mol

Explanation:

there are 22.990 g/mol of Na

20.7/22.99 = 0.900391 mol

about 0.9 mol

8 0

3 years ago

Why is studying light and electrons important for chemistry and understanding the universe?

Brut [27]

Explanation :

The study of light and electrons are important for chemistry & universe.

As we know, everything is made up of particles even light & universe also. The particles are made of atoms and that atoms are made up of electrons, protons & neutrons.

An electron is one of the most important type of subatomic particles. Electrons combine with the proton to form atom. These electrons, protons & neutrons play a vital role in chemistry and universe.

The importance of an electron is that when two atoms react with each other or approach each other, their outermost shells come into contact first and these outermost shells electrons are involved in the chemical reaction.

Also important for chemical reactions, creating bonds, for electricity and the understanding of electrons has allowed for the better understanding of some forces which are in our universe such as electromagnetic force.

We know that the light is act as particle nature and it is a part of universe. As we know that chemists are only responsible for the chemical's study. Chemists cannot study the whole universe that is why they study light and the light is important because nothing would be able to survive.

The studying of light is important for the photoelectric effect, absorption, bio-molecules synthesis, vitamin D synthesis, vision, colors, drying & evaporation, sterilization, solar energy, spectroscopy, signal system and also for electron excitation.

7 0

3 years ago

A 25.0g sample of brass, which has a specific heat capacity of 0.375·J·g−1°C−1, is dropped into an insulated container containin

Angelina_Jolie [31]

Answer:

The equilibrium temperature of water is 25.6 °C

Explanation:

Step 1: Data given

Mass of the sample of brass = 25.0 grams

The specific heat capacity = 0.375 J/g°C

Mass of water = 250.0 grams

Temperature of water = 25.0 °C

The initial temperature of the brass is 96.7°C

Step 2: Calculate the equilibrium temperature

Heat lost = heat gained

Q(sample) = -Q(water)

Q = m*C* ΔT

m(sample)*c(sample)*ΔT(sample) = - m(water)*c(water)*ΔT(water)

⇒m(sample) = the mass of the sample of brass = 25.0 grams

⇒with c(sample) =The specific heat capacity = 0.375 J/g°C

⇒with ΔT = the change of temperature = T2 - T1 =T2 - 96.7 °C

⇒with m(water) = the mass of the water = 250.0 grams

⇒with c(water) = the specific heat capacity = 4.184 J/g°C

⇒with ΔT(water) = the change of temperature of water = T2 - T1 = T2 - 25.0°C

25.0 * 0.375 * (T2 - 96.7) = - 250.0 * 4.184 J/g°C * (T2 - 25.0°C)

9.375T2 - 906.56 = -1046T2 + 26150

9.375T2 + 1046T2 = 26150 + 906.56

1055.375T2 = 27056.26

T2 = 25.6 °C

The equilibrium temperature of water is 25.6 °C

4 0

3 years ago