Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
A residue from a gunshot is most likely gun powder, which tells you what kind of bullet was shot and the type of gun that was used to shoot the target/victim/person. Some complications may be that there is more than one gun or weapon which uses that residue, so it may be hard to pinpoint it and the bullet can't really tell you who it is unless there's DNA on the bullet, and the chemicals of the bullet may even destroy evidence.
The answer is: A molecule with a difference in electrical charge between two ends.
Electronegativity (χ) is a property that describes the tendency of an atom to attract a shared pair of electrons.
Atoms with higher electronegativity attracts more electrons towards it, electrons are closer to that atom.
For example fluorine has electronegativity approximately χ = 4 and oxygen χ = 3,5, fluorine attracts electron and he has negative charge and oxygen has positive charge.
Answer:
Explanation:
You would have to add up the atomic masses of all the compounds in the compound, making sure you include how many molecules of each are in the compound
For example, in CuSOA we have 1 molecule of Cu and S, as 4 molecules of O
The atomic masses are as follows:
Cu = 63.55 u
S = 32.065 u
O = 15.99 units
This is how we would add it up:
(Atomic mass of Cu) + (Atomic mass of S) + 4(Atomic Mass of O)
(63.55) + (32.065) + 4(15.99)
(63.55) + (32.065) + 63.96
= 159.575 u
