Question:
The options are;
a. Temperature
b. Thermal Energy
c. Hotness
d. Fire Energy
Answer:
The correct option is;
b. Thermal energy
Explanation:
A burner on a stove produces thermal energy which is used to raise the temperature of the metal container (kettle, pot or pans) in which items are placed for heating.
Thermal energy is the internal energy of the system given off as heat which when transferred from one body to another causes the temperature of the receiving body to rise. Thermal energy in a burner is given off when the gaseous fuel reacts or burns in the presence of or with oxygen to produce carbon dioxide and water vapor in an exothermic reaction.
4C + 5H₂ + 13/2O₂ (-125 kJ) → C₄H₁₀ + O₂ → CO₂ + H₂O (-2877 kJ).
Use Raoult's Law:
Psolution = (χsolvent) (P°solvent)
24.90 = (x) (25.756)
x = 0.966765 (this is the solvent mole fraction)
χsolute = 1 - 0.966765 = 0.033235
χsolute = 0.03324 (to four sig figs)
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
<u>Why is it important to keep the two sides of an equation balanced when solving?</u>
If two expressions are equal to each other, and you add the same value to both sides of the equation, the equation will remain equal. When you solve an equation, you find the value of the variable that makes the equation true.
<u>What other properties do we use to rewrite expressions and equations?</u>
State of matter
Please vote for Brainliest and I hope this helps!
