The clay soil holds the least amount if water.
This is an incomplete question, here is a complete question.
Calculate the solubility of each of the following compounds in moles per liter. Ignore any acid-base properties.
CaCO₃, Ksp = 8.7 × 10⁻⁹
Answer : The solubility of CaCO₃ is, 
Explanation :
As we know that CaCO₃ dissociates to give 
ion and 
ion.
The solubility equilibrium reaction will be:
The expression for solubility constant for this reaction will be,
![K_{sp}=[Ca^{2+}][CO_3^{2-}]](https://tex.z-dn.net/?f=K_%7Bsp%7D%3D%5BCa%5E%7B2%2B%7D%5D%5BCO_3%5E%7B2-%7D%5D)
Let solubility of CaCO₃ be, 's'
Therefore, the solubility of CaCO₃ is,
Answer: 0.24 moles
Explanation:
Molecular Mass of NaCl (23 + 35.5) = 58.5g
58.5g of Sodium Chloride -------> 1 mole of NaCl
∴ 13.8g of Sodium Chloride ------> 1 ÷58.5 x 13.8 = 0.2358974 ≈ 0.24moles
-
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Mrna is a single strand but DNA is a double helix. (mrna is smaller)
