Answer:
92.2 m
Explanation:
Given that:=
The breadth = 304 mm
Height = 0.014 mm
Let Length = x mm
Volume = 
Thus,
Volume = 
Also, 1 mm³ = 0.001 cm³
So, volume = 0.004256 cm³
Given that density = 2.7 g/cm³
Mass = 1.06 kg = 1060 g
So,
So,
0.004256*x = 392.59
x = 92243.89 mm
Length of foil = 92243.89 mm = 92.2 m
Hello.
He have that:
[H+][OH-] = 10⁻¹⁴
3.64 x 10⁻⁸ [OH-] = 10⁻¹⁴
[OH-] = 0.27 x 10⁻⁶ mol/L
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
This depends in what type reaction is occurring. It may be an endothermic reaction or an exothermic reaction. If the reaction is endothermic or heat is being absorbed by the reaction, then the forward reaction is favored or the products are being formed by the addition of heat. If the reaction is exothermic or heat is released by the reaction, then the backward reaction is favored or the reactants are being formed by the addition of heat.
