Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
To convert the formula unit to mass, we need to divide the given formula units by Avogadro's number, 6.022 x 10^23 and we get the mole of beryllium nitrate. To convert to mass, we need to multiply the number of moles with the molecular formula of the compound which is 133.022 g/mol.The answer is 0.006185 g or 6.185 mg.
sjnsjshdjahshabbxbabsbasjsjjsjs
C. Planets can move at a varying speed due to forces exerted in space.
Answer:
CuSO4 + 2 NaOH = Cu(OH)2 + Na2SO4
