It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
<h3><u>Answer;</u></h3>
exceeds evaporation over land
Precipitation<u> exceeds evaporation over land </u>
<h3><u>Explanation;</u></h3>
- <em><u>In order to maintain earths water balance, evaporation exceeds precipitation over oceans but precipitation exceeds evaporation over land.</u></em>
- Water evaporates into the atmosphere from the ocean and to a much lesser extent from the continents. Winds transport this moisture-laden air, often great distances, until conditions cause the moisture to condense into clouds and to precipitate and fall.
- Most precipitation originates by evaporation from the oceans. Over time, water evaporated from the oceans is replenished by inflow of freshwater from rivers and streams.
A solution is prepared by adding 1.43 mol of potassium chloride (kcl) to 889 g of water. The concentration of kcl is 1.61 molal.
mol of Kcl (potassium chloride)= 1.43
water = 889 g
the formula for calculating molality is:
molality = moles of solute/kilograms of solvent
1kg = 1000g so, 889g = 0.889kg
m = 1.43/0.889 = 1.61 molal
