To convert the mass of a compound to formula units, the conversion factor is Avogadro's number, 6.022 x10^23 formula units/ mol and its molar mass. In this case, we are given with 19.0 grams of magnesium chloride which has a mass of 95.21 g/mol. Hence the answer is 1.20 x 10^23 formula units.
Answer: 460.624
Explanation:
1. Multiply the numbers
(24.5260 x 2.56) + 397.84
= (62.784) + 397.84
2. Add the numbers
(62.784) + 397.84
= 460.624
I mostly believe in between D and B beacuse K3po4 and caco3 is not an element equation
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
fH = - 3,255.7 kJ/mol
Explanation:
Because the bomb calorimeter is adiabatic (q =0), there'is no heat inside or outside it, so the heat flow from the combustion plus the heat flow of the system (bomb, water, and the contents) must be 0.
Qsystem + Qcombustion = 0
Qsystem = heat capacity*ΔT
10000*(25.000 - 20.826) + Qc = 0
Qcombustion = - 41,740 J = - 41.74 kJ
So, the enthaply of formation of benzene (fH) at 298.15 K (25.000 ºC) is the heat of the combustion, divided by the number of moles of it. The molar mass od benzene is: 6x12 g/mol of C + 6x1 g/mol of H = 78 g/mol, and:
n = mass/molar mass = 1/ 78
n = 0.01282 mol
fH = -41.74/0.01282
fH = - 3,255.7 kJ/mol
