All categories

3 years ago

2,3,5-trimethylhexane

Chemistry

1 answer:

dedylja [7]3 years ago

5 0

2,3,5-trimethylhexane

C9H20

Molecular weight= 128.5g/mol

CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3

You might be interested in

The frequency factors for these two reactions are very close to each other in value. Assuming that they are the same, compute th

MrRissso [65]

The question is incomplete, complete question is :

The frequency factors for these two reactions are very close to each other in value. Assuming that they are the same, compute the ratio of the reaction rate constants for these two reactions at 25°C.

$\frac{K_1}{K_2}=?$

Activation energy of the reaction 1 , $Ea_1$ = 14.0 kJ/mol

Activation energy of the reaction 2, $Ea_1$ = 11.9 kJ/mol

Answer:

0.4284 is the ratio of the rate constants.

Explanation:

According to the Arrhenius equation,

$K=A\times e^{\frac{-Ea}{RT}}$

The expression used with catalyst and without catalyst is,

$\frac{K_2}{K_1}=\frac{A\times e^{\frac{-Ea_2}{RT}}}{A\times e^{\frac{-Ea_1}{RT}}}$

$\frac{K_2}{K_1}=e^{\frac{Ea_1-Ea_2}{RT}}$

where,

$K_2$ = rate constant reaction -1

$K_1$ = rate constant reaction -2

Activation energy of the reaction 1 , $Ea_1$ = 14.0 kJ/mol = 14,000 J

Activation energy of the reaction 2, $Ea_1$ = 11.9 kJ/mol = 11,900 J

R = gas constant = 8.314 J/ mol K

T = temperature = $25^oC=273+25=298 K$

Now put all the given values in this formula, we get

$\frac{K_1}{K_2}=e^{\frac{11,900- 14,000Jl}{8.314 J/mol K\times 298 K}}=2.3340$

0.4284 is the ratio of the rate constants.

7 0

3 years ago

If the acceleration is 600 m/s/s and the mass is 300 kg, what force is acting on the object?

vampirchik [111]

Explanation:

Acceleration (a) = 600 m/s²

Mass (m) = 300 kg

Force (F) = ?

We know

F = m * a

= 300 * 600

=180000 Newton

The force acting on the object is 18000 Newton.

5 0

2 years ago

Read 2 more answers

Plants require nitrogen fixed in compounds to grow. A higher the percentage of nitrogen results in improved plant growth. Which

Brut [27]

Explanation:

c and d. I'm not sure which one is better tho

4 0

2 years ago

Why does a higher concentration make a reaction faster?

myrzilka [38]

Option B is correct,
With increase in concentration the density of reactants increases and the system becomes more crowded, the greater the reactants will come in contact with each other and collisions occur. If collision is in proper orientation and has optimum energy then its fruitful and yields product. So, the greater the number of reactants, the greater will be the chances of collision and the greater will be the production of products per unit time and hence, greater is the rate of reaction.

6 0

3 years ago

Read 2 more answers

What are two properties of most nonmetals

vekshin1

Answer: Summary of Common Properties

High ionization energies.
High electronegativities.
Poor thermal conductors.
Poor electrical conductors.
Brittle solids—not malleable or ductile.
Little or no metallic luster.
Gain electrons easily.
Dull, not metallic-shiny, although they may be colorful.

Explanation:

<u><em>May I please have brainiest?</em></u>

3 0

3 years ago

Read 2 more answers