Only C. a temperature probe sends its measurement directly to a computer.
However, you can buy stopwatches that send their measurements via Bluetooth to your smartphone and you can then download them to a computer.
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
Avogadro's number is 6.022×1023 molecules. With Avogadro's number, scientists can discuss and compare very large numbers, which is useful because substances in everyday quantities contain very large numbers of atoms and molecules.
please mark Brainliest if it helps!
<u>Given:</u>
H2(g) + Cl2 (g) → 2HCl (g)
<u>To determine:</u>
The enthalpy of the reaction and whether it is endo or exothermic
<u>Explanation:</u>
Enthalpy of a reaction is given by the difference between the enthalpy of formation of reactants and products
ΔH = ∑nHf (products) - ∑nHf (reactants)
= [2Hf(HCl)] - [Hf(H2) + Hf(Cl2)] = 2 (-92.3) kJ = - 184.6 kJ
Since the reaction enthalpy is negative, the reaction is exothermic
<u>Ans:</u> The enthalpy of reaction is -184. kJ and the reaction is exothermic
Answer:
The muscular and nervous systems enable the involuntary breathing mechanism. The main muscles in inhalation and exhalation are the diaphragm and the intercostals (shown in blue), as well as other muscles. Exhalation is a passive action, as the lungs recoil and shrink when the muscles relax.
Explanation:
